C20H38F2OSi — CID 70995406
[(1R,3aR,4S,7aR)-1-[(2R)-4,4-difluorobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane (PubChem CID 70995406) has the molecular formula C20H38F2OSi and a molecular weight of 360.61 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2R)-4,4-difluorobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2R)-4,4-difluorobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 70995406 |
| Molecular Formula | C20H38F2OSi |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2R)-4,4-difluorobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)[C@@H]([C@H](C)CC(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C20H38F2OSi/c1-6-24(7-2,8-3)23-18-10-9-13-20(5)16(11-12-17(18)20)15(4)14-19(21)22/h15-19H,6-14H2,1-5H3/t15-,16-,17+,18+,20-/m1/s1 |
| InChIKey | UOOZLFHNHQKZBI-PKRADWSKSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|