About 2-(butoxymethyl)-4,5-dichloropyridazin-3-one
2-(butoxymethyl)-4,5-dichloropyridazin-3-one (PubChem CID 70995502) has the molecular formula C9H12Cl2N2O2
and a molecular weight of 251.11 g/mol. Its IUPAC name is 2-(butoxymethyl)-4,5-dichloropyridazin-3-one.
Molecular Properties
| Compound Name | 2-(butoxymethyl)-4,5-dichloropyridazin-3-one |
| PubChem CID | 70995502 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-(butoxymethyl)-4,5-dichloropyridazin-3-one |
| SMILES | CCCCOCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C9H12Cl2N2O2/c1-2-3-4-15-6-13-9(14)8(11)7(10)5-12-13/h5H,2-4,6H2,1H3 |
| InChIKey | WOYPSBKPTBEKED-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(butoxymethyl)-4,5-dichloropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butoxymethyl)-4,5-dichloropyridazin-3-one?
The IUPAC name of 2-(butoxymethyl)-4,5-dichloropyridazin-3-one (CID 70995502) is 2-(butoxymethyl)-4,5-dichloropyridazin-3-one.
What is the SMILES notation for 2-(butoxymethyl)-4,5-dichloropyridazin-3-one?
The canonical SMILES for 2-(butoxymethyl)-4,5-dichloropyridazin-3-one is CCCCOCn1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of 2-(butoxymethyl)-4,5-dichloropyridazin-3-one?
The InChIKey is WOYPSBKPTBEKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2O2/c1-2-3-4-15-6-13-9(14)8(11)7(10)5-12-13/h5H,2-4,6H2,1H3.
What are the key properties of 2-(butoxymethyl)-4,5-dichloropyridazin-3-one?
2-(butoxymethyl)-4,5-dichloropyridazin-3-one has a molecular weight of 251.11 g/mol, XLogP of 2.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butoxymethyl)-4,5-dichloropyridazin-3-one is sourced from PubChem (CID 70995502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).