About 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one
2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 70995660) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
Molecular Properties
| Compound Name | 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| PubChem CID | 70995660 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1=NC2(CCN(C(C)C)CC2)C(=O)N1 |
| InChI | InChI=1S/C11H19N3O/c1-8(2)14-6-4-11(5-7-14)10(15)12-9(3)13-11/h8H,4-7H2,1-3H3,(H,12,13,15) |
| InChIKey | IHHISBYWVKXDSS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The IUPAC name of 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (CID 70995660) is 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
What is the SMILES notation for 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The canonical SMILES for 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one is CC1=NC2(CCN(C(C)C)CC2)C(=O)N1.
What is the InChIKey of 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
The InChIKey is IHHISBYWVKXDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-8(2)14-6-4-11(5-7-14)10(15)12-9(3)13-11/h8H,4-7H2,1-3H3,(H,12,13,15).
What are the key properties of 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one?
2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one has a molecular weight of 209.29 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-8-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one is sourced from PubChem (CID 70995660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).