C32H32N8O3 — CID 70996194
3-but-2-ynyl-2-[(3R)-3-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-5-(methylamino)-N-[(4-methylquinazolin-2-yl)methyl]imidazole-4-carboxamide (PubChem CID 70996194) has the molecular formula C32H32N8O3 and a molecular weight of 576.66 g/mol. Its IUPAC name is 3-but-2-ynyl-2-[(3R)-3-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-5-(methylamino)-N-[(4-methylquinazolin-2-yl)methyl]imidazole-4-carboxamide.
| Compound Name | 3-but-2-ynyl-2-[(3R)-3-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-5-(methylamino)-N-[(4-methylquinazolin-2-yl)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 70996194 |
| Molecular Formula | C32H32N8O3 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 3-but-2-ynyl-2-[(3R)-3-(1,3-dioxoisoindol-2-yl)piperidin-1-yl]-5-(methylamino)-N-[(4-methylquinazolin-2-yl)methyl]imidazole-4-carboxamide |
| SMILES | CC#CCn1c(N2CCC[C@@H](N3C(=O)c4ccccc4C3=O)C2)nc(NC)c1C(=O)NCc1nc(C)c2ccccc2n1 |
| InChI | InChI=1S/C32H32N8O3/c1-4-5-17-39-27(29(41)34-18-26-35-20(2)22-12-8-9-15-25(22)36-26)28(33-3)37-32(39)38-16-10-11-21(19-38)40-30(42)23-13-6-7-14-24(23)31(40)43/h6-9,12-15,21,33H,10-11,16-19H2,1-3H3,(H,34,41)/t21-/m1/s1 |
| InChIKey | WBYTYXUNDDUGDT-OAQYLSRUSA-N |
| XLogP | 3.39 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|