C29H50O13Si — CID 70996263
[(3R,4S,6S)-3,4,5-triacetyloxy-6-[(E)-2,4-dimethyl-7-triethoxysilylhept-2-enoxy]oxan-2-yl]methyl acetate (PubChem CID 70996263) has the molecular formula C29H50O13Si and a molecular weight of 634.79 g/mol. Its IUPAC name is [(3R,4S,6S)-3,4,5-triacetyloxy-6-[(E)-2,4-dimethyl-7-triethoxysilylhept-2-enoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-3,4,5-triacetyloxy-6-[(E)-2,4-dimethyl-7-triethoxysilylhept-2-enoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70996263 |
| Molecular Formula | C29H50O13Si |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | [(3R,4S,6S)-3,4,5-triacetyloxy-6-[(E)-2,4-dimethyl-7-triethoxysilylhept-2-enoxy]oxan-2-yl]methyl acetate |
| SMILES | CCO[Si](CCCC(C)/C=C(\C)CO[C@H]1OC(COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)C1OC(C)=O)(OCC)OCC |
| InChI | InChI=1S/C29H50O13Si/c1-10-36-43(37-11-2,38-12-3)15-13-14-19(4)16-20(5)17-35-29-28(41-24(9)33)27(40-23(8)32)26(39-22(7)31)25(42-29)18-34-21(6)30/h16,19,25-29H,10-15,17-18H2,1-9H3/b20-16+/t19?,25?,26-,27+,28?,29+/m1/s1 |
| InChIKey | ABEHNVVGYSXSCY-JFYBWQPBSA-N |
| XLogP | 3.50 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|