C24H31NO3 — CID 70996366
(2S,3S,4aR,10aR)-4a-ethyl-2-methyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthrene-2,3-diol (PubChem CID 70996366) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2S,3S,4aR,10aR)-4a-ethyl-2-methyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthrene-2,3-diol.
| Compound Name | (2S,3S,4aR,10aR)-4a-ethyl-2-methyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthrene-2,3-diol |
|---|---|
| PubChem CID | 70996366 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2S,3S,4aR,10aR)-4a-ethyl-2-methyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthrene-2,3-diol |
| SMILES | CC[C@@]12C[C@H](O)[C@@](C)(O)C[C@H]1CCc1cc(OCc3cccnc3C)ccc12 |
| InChI | InChI=1S/C24H31NO3/c1-4-24-14-22(26)23(3,27)13-19(24)8-7-17-12-20(9-10-21(17)24)28-15-18-6-5-11-25-16(18)2/h5-6,9-12,19,22,26-27H,4,7-8,13-15H2,1-3H3/t19-,22+,23+,24-/m1/s1 |
| InChIKey | YLSJKYROCQKYNS-QLBRKBSLSA-N |
| XLogP | 4.08 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |