C16H33N3 — CID 70996991
4-(1-ethylpiperidin-4-yl)-1,2,2,6,6-pentamethylpiperazine (PubChem CID 70996991) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is 4-(1-ethylpiperidin-4-yl)-1,2,2,6,6-pentamethylpiperazine.
| Compound Name | 4-(1-ethylpiperidin-4-yl)-1,2,2,6,6-pentamethylpiperazine |
|---|---|
| PubChem CID | 70996991 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | 4-(1-ethylpiperidin-4-yl)-1,2,2,6,6-pentamethylpiperazine |
| SMILES | CCN1CCC(N2CC(C)(C)N(C)C(C)(C)C2)CC1 |
| InChI | InChI=1S/C16H33N3/c1-7-18-10-8-14(9-11-18)19-12-15(2,3)17(6)16(4,5)13-19/h14H,7-13H2,1-6H3 |
| InChIKey | MJMOEKIKSZLYNM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |