C40H55NO5Si — CID 70997058
[7-[(2R,3R,11bR)-9,10-dimethoxy-2-(oxan-2-yloxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl]-2-methylheptan-2-yl]-hydroxy-diphenylsilane (PubChem CID 70997058) has the molecular formula C40H55NO5Si and a molecular weight of 657.97 g/mol. Its IUPAC name is [7-[(2R,3R,11bR)-9,10-dimethoxy-2-(oxan-2-yloxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl]-2-methylheptan-2-yl]-hydroxy-diphenylsilane.
| Compound Name | [7-[(2R,3R,11bR)-9,10-dimethoxy-2-(oxan-2-yloxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl]-2-methylheptan-2-yl]-hydroxy-diphenylsilane |
|---|---|
| PubChem CID | 70997058 |
| Molecular Formula | C40H55NO5Si |
| Molecular Weight | 657.97 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | [7-[(2R,3R,11bR)-9,10-dimethoxy-2-(oxan-2-yloxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-3-yl]-2-methylheptan-2-yl]-hydroxy-diphenylsilane |
| SMILES | COc1cc2c(cc1OC)[C@H]1C[C@@H](OC3CCCCO3)[C@H](CCCCCC(C)(C)[Si](O)(c3ccccc3)c3ccccc3)CN1CC2 |
| InChI | InChI=1S/C40H55NO5Si/c1-40(2,47(42,32-17-9-5-10-18-32)33-19-11-6-12-20-33)23-14-7-8-16-31-29-41-24-22-30-26-37(43-3)38(44-4)27-34(30)35(41)28-36(31)46-39-21-13-15-25-45-39/h5-6,9-12,17-20,26-27,31,35-36,39,42H,7-8,13-16,21-25,28-29H2,1-4H3/t31-,35-,36-,39?/m1/s1 |
| InChIKey | OJCBBKVOSGVZIP-CYYJEVCFSA-N |
| XLogP | 7.02 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.97 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|