C32H52O2 — CID 70997354
[(5aR)-1,5a,5b,8,8,11a-hexamethyl-3a-[(E)-prop-1-enyl]-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate (PubChem CID 70997354) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is [(5aR)-1,5a,5b,8,8,11a-hexamethyl-3a-[(E)-prop-1-enyl]-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [(5aR)-1,5a,5b,8,8,11a-hexamethyl-3a-[(E)-prop-1-enyl]-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 70997354 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | [(5aR)-1,5a,5b,8,8,11a-hexamethyl-3a-[(E)-prop-1-enyl]-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate |
| SMILES | C/C=C/C12CCC(C)C1C1CCC3C4(C)CCC(OC(C)=O)C(C)(C)C4CCC3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H52O2/c1-9-15-32-18-12-21(2)27(32)23-10-11-25-29(6)16-14-26(34-22(3)33)28(4,5)24(29)13-17-31(25,8)30(23,7)19-20-32/h9,15,21,23-27H,10-14,16-20H2,1-8H3/b15-9+/t21?,23?,24?,25?,26?,27?,29?,30-,31?,32?/m1/s1 |
| InChIKey | QNDLFGYJYXTKJP-XLZRPIRKSA-N |
| XLogP | 8.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|