About 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one
3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 70997461) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one |
| PubChem CID | 70997461 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CC/C=C\CC/C=C/CN1CC2CC2C1=O |
| InChI | InChI=1S/C14H21NO/c1-2-3-4-5-6-7-8-9-15-11-12-10-13(12)14(15)16/h3-4,7-8,12-13H,2,5-6,9-11H2,1H3/b4-3-,8-7+ |
| InChIKey | PGWBZUKMLHDGCS-ODYTWBPASA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
The IUPAC name of 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one (CID 70997461) is 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
The canonical SMILES for 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one is CC/C=C\CC/C=C/CN1CC2CC2C1=O.
What is the InChIKey of 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
The InChIKey is PGWBZUKMLHDGCS-ODYTWBPASA-N. The full InChI is InChI=1S/C14H21NO/c1-2-3-4-5-6-7-8-9-15-11-12-10-13(12)14(15)16/h3-4,7-8,12-13H,2,5-6,9-11H2,1H3/b4-3-,8-7+.
What are the key properties of 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one has a molecular weight of 219.33 g/mol, XLogP of 2.77, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 70997461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).