About 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one
4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 70997529) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one |
| PubChem CID | 70997529 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CC/C=C\CC/C=C/CN1C(=O)C2CC2C1C |
| InChI | InChI=1S/C15H23NO/c1-3-4-5-6-7-8-9-10-16-12(2)13-11-14(13)15(16)17/h4-5,8-9,12-14H,3,6-7,10-11H2,1-2H3/b5-4-,9-8+ |
| InChIKey | LYXUYBZOQPUIHQ-FTGFODROSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
The IUPAC name of 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one (CID 70997529) is 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
The canonical SMILES for 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one is CC/C=C\CC/C=C/CN1C(=O)C2CC2C1C.
What is the InChIKey of 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
The InChIKey is LYXUYBZOQPUIHQ-FTGFODROSA-N. The full InChI is InChI=1S/C15H23NO/c1-3-4-5-6-7-8-9-10-16-12(2)13-11-14(13)15(16)17/h4-5,8-9,12-14H,3,6-7,10-11H2,1-2H3/b5-4-,9-8+.
What are the key properties of 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one?
4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one has a molecular weight of 233.35 g/mol, XLogP of 3.16, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[(2E,6Z)-nona-2,6-dienyl]-3-azabicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 70997529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).