C22H25FO5S — CID 70998405
(3S,3'R,5'S)-5-[[4-(2-fluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol (PubChem CID 70998405) has the molecular formula C22H25FO5S and a molecular weight of 420.50 g/mol. Its IUPAC name is (3S,3'R,5'S)-5-[[4-(2-fluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol.
| Compound Name | (3S,3'R,5'S)-5-[[4-(2-fluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 70998405 |
| Molecular Formula | C22H25FO5S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (3S,3'R,5'S)-5-[[4-(2-fluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
| SMILES | OCC1S[C@]2(OCc3ccc(Cc4ccc(CCF)cc4)cc32)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C22H25FO5S/c23-8-7-13-1-3-14(4-2-13)9-15-5-6-16-12-28-22(17(16)10-15)21(27)20(26)19(25)18(11-24)29-22/h1-6,10,18-21,24-27H,7-9,11-12H2/t18?,19-,20?,21-,22+/m1/s1 |
| InChIKey | AIRXXCOYVSZWHR-PKOSHIGMSA-N |
| XLogP | 1.66 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |