C25H22Cl2N2O2 — CID 70998428
(3R,4'R,6'S)-6-chloro-6'-(3-chlorophenyl)-4'-cyclohexa-2,4-dien-1-ylspiro[1H-indole-3,5'-azepane]-2,2'-dione (PubChem CID 70998428) has the molecular formula C25H22Cl2N2O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is (3R,4'R,6'S)-6-chloro-6'-(3-chlorophenyl)-4'-cyclohexa-2,4-dien-1-ylspiro[1H-indole-3,5'-azepane]-2,2'-dione.
| Compound Name | (3R,4'R,6'S)-6-chloro-6'-(3-chlorophenyl)-4'-cyclohexa-2,4-dien-1-ylspiro[1H-indole-3,5'-azepane]-2,2'-dione |
|---|---|
| PubChem CID | 70998428 |
| Molecular Formula | C25H22Cl2N2O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (3R,4'R,6'S)-6-chloro-6'-(3-chlorophenyl)-4'-cyclohexa-2,4-dien-1-ylspiro[1H-indole-3,5'-azepane]-2,2'-dione |
| SMILES | O=C1C[C@H](C2C=CC=CC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H](c2cccc(Cl)c2)CN1 |
| InChI | InChI=1S/C25H22Cl2N2O2/c26-17-8-4-7-16(11-17)21-14-28-23(30)13-20(15-5-2-1-3-6-15)25(21)19-10-9-18(27)12-22(19)29-24(25)31/h1-5,7-12,15,20-21H,6,13-14H2,(H,28,30)(H,29,31)/t15?,20-,21+,25-/m1/s1 |
| InChIKey | GEXROCGUPQKWBI-QIMADEKVSA-N |
| XLogP | 5.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |