C24H21N3O2S — CID 70998766
14-[4-(aminomethyl)piperidin-4-yl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione (PubChem CID 70998766) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is 14-[4-(aminomethyl)piperidin-4-yl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione.
| Compound Name | 14-[4-(aminomethyl)piperidin-4-yl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
|---|---|
| PubChem CID | 70998766 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 14-[4-(aminomethyl)piperidin-4-yl]-8-thia-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
| SMILES | NCC1(n2c(=O)c3ccc4sc5ccccc5c5ccc(c2=O)c3c45)CCNCC1 |
| InChI | InChI=1S/C24H21N3O2S/c25-13-24(9-11-26-12-10-24)27-22(28)16-6-5-15-14-3-1-2-4-18(14)30-19-8-7-17(23(27)29)20(16)21(15)19/h1-8,26H,9-13,25H2 |
| InChIKey | WSCGEWZFCYGQNO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|