C26H31N3O3S — CID 70998943
4-[piperidin-4-yl-[[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]methyl]amino]benzenethiol (PubChem CID 70998943) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 4-[piperidin-4-yl-[[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]methyl]amino]benzenethiol.
| Compound Name | 4-[piperidin-4-yl-[[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]methyl]amino]benzenethiol |
|---|---|
| PubChem CID | 70998943 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 4-[piperidin-4-yl-[[5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]methyl]amino]benzenethiol |
| SMILES | COc1cc(-c2cncc(CN(c3ccc(S)cc3)C3CCNCC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H31N3O3S/c1-30-24-13-19(14-25(31-2)26(24)32-3)20-12-18(15-28-16-20)17-29(22-8-10-27-11-9-22)21-4-6-23(33)7-5-21/h4-7,12-16,22,27,33H,8-11,17H2,1-3H3 |
| InChIKey | PXTBTLRZNGOLHP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|