C18H21ClN4O2 — CID 70999038
6-chloro-N-(4,6-dimethoxypyrimidin-2-yl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine (PubChem CID 70999038) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 6-chloro-N-(4,6-dimethoxypyrimidin-2-yl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine.
| Compound Name | 6-chloro-N-(4,6-dimethoxypyrimidin-2-yl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 70999038 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 6-chloro-N-(4,6-dimethoxypyrimidin-2-yl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine |
| SMILES | COc1cc(OC)nc(NC2CCCC3c4cc(Cl)ccc4NC23)n1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-24-15-9-16(25-2)23-18(22-15)21-14-5-3-4-11-12-8-10(19)6-7-13(12)20-17(11)14/h6-9,11,14,17,20H,3-5H2,1-2H3,(H,21,22,23) |
| InChIKey | KLGPESPMQPLNHF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |