About 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole
7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole (PubChem CID 70999131) has the molecular formula C21H19ClN2OS
and a molecular weight of 382.92 g/mol. Its IUPAC name is 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole |
| PubChem CID | 70999131 |
| Molecular Formula | C21H19ClN2OS |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole |
| SMILES | CCSc1cccc(-c2cc(Cl)c(OC)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C21H19ClN2OS/c1-4-26-14-7-5-6-13(9-14)15-10-17(22)20(25-3)19-18(15)16-8-12(2)11-23-21(16)24-19/h5-11H,4H2,1-3H3,(H,23,24) |
| InChIKey | WQRIMHOOQZTDHT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole?
The IUPAC name of 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole (CID 70999131) is 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole?
The canonical SMILES for 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole is CCSc1cccc(-c2cc(Cl)c(OC)c3[nH]c4ncc(C)cc4c23)c1.
What is the InChIKey of 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole?
The InChIKey is WQRIMHOOQZTDHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN2OS/c1-4-26-14-7-5-6-13(9-14)15-10-17(22)20(25-3)19-18(15)16-8-12(2)11-23-21(16)24-19/h5-11H,4H2,1-3H3,(H,23,24).
What are the key properties of 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole?
7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole has a molecular weight of 382.92 g/mol, XLogP of 6.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-(3-ethylsulfanylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 70999131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).