C25H25ClN2O — CID 70999136
3-[3-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]phenyl]-1,1-dimethylurea (PubChem CID 70999136) has the molecular formula C25H25ClN2O and a molecular weight of 404.94 g/mol. Its IUPAC name is 3-[3-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[3-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70999136 |
| Molecular Formula | C25H25ClN2O |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 3-[3-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cccc(CC2c3ccccc3CCc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C25H25ClN2O/c1-28(2)25(29)27-21-8-5-6-17(14-21)15-24-22-9-4-3-7-18(22)10-11-19-16-20(26)12-13-23(19)24/h3-9,12-14,16,24H,10-11,15H2,1-2H3,(H,27,29) |
| InChIKey | RELVPZISPAZPJG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |