C30H36N2O3S — CID 70999165
N-[3-[2-methyl-6-(2-piperidin-1-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]phenyl]methanesulfonamide (PubChem CID 70999165) has the molecular formula C30H36N2O3S and a molecular weight of 504.70 g/mol. Its IUPAC name is N-[3-[2-methyl-6-(2-piperidin-1-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-methyl-6-(2-piperidin-1-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70999165 |
| Molecular Formula | C30H36N2O3S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | N-[3-[2-methyl-6-(2-piperidin-1-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]phenyl]methanesulfonamide |
| SMILES | CC1(c2cccc(NS(C)(=O)=O)c2)c2ccccc2CCc2cc(OCCN3CCCCC3)ccc21 |
| InChI | InChI=1S/C30H36N2O3S/c1-30(25-10-8-11-26(22-25)31-36(2,33)34)28-12-5-4-9-23(28)13-14-24-21-27(15-16-29(24)30)35-20-19-32-17-6-3-7-18-32/h4-5,8-12,15-16,21-22,31H,3,6-7,13-14,17-20H2,1-2H3 |
| InChIKey | YSHJYGPFEVJZLT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |