About 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole
2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole (PubChem CID 70999453) has the molecular formula C21H17F2P
and a molecular weight of 338.34 g/mol. Its IUPAC name is 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole.
Molecular Properties
| Compound Name | 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole |
| PubChem CID | 70999453 |
| Molecular Formula | C21H17F2P |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole |
| SMILES | Cc1cc2c(cc1F)c1cc(F)c(C)c(C)c1p2-c1ccccc1 |
| InChI | InChI=1S/C21H17F2P/c1-12-9-20-16(10-18(12)22)17-11-19(23)13(2)14(3)21(17)24(20)15-7-5-4-6-8-15/h4-11H,1-3H3 |
| InChIKey | CBPRBHGTYRWSCK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole?
The IUPAC name of 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole (CID 70999453) is 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole.
What is the SMILES notation for 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole?
The canonical SMILES for 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole is Cc1cc2c(cc1F)c1cc(F)c(C)c(C)c1p2-c1ccccc1.
What is the InChIKey of 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole?
The InChIKey is CBPRBHGTYRWSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F2P/c1-12-9-20-16(10-18(12)22)17-11-19(23)13(2)14(3)21(17)24(20)15-7-5-4-6-8-15/h4-11H,1-3H3.
What are the key properties of 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole?
2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole has a molecular weight of 338.34 g/mol, XLogP of 7.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-difluoro-3,4,7-trimethyl-5-phenylbenzo[b]phosphindole is sourced from PubChem (CID 70999453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).