About methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate
methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate (PubChem CID 70999461) has the molecular formula C20H28FNO6
and a molecular weight of 397.44 g/mol. Its IUPAC name is methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate.
Molecular Properties
| Compound Name | methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate |
| PubChem CID | 70999461 |
| Molecular Formula | C20H28FNO6 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate |
| SMILES | COCC(COC)N(C(=O)C1CCCCC1)c1cc(F)c(O)cc1C(=O)OC |
| InChI | InChI=1S/C20H28FNO6/c1-26-11-14(12-27-2)22(19(24)13-7-5-4-6-8-13)17-10-16(21)18(23)9-15(17)20(25)28-3/h9-10,13-14,23H,4-8,11-12H2,1-3H3 |
| InChIKey | OMFSVRITDBVKML-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate?
The IUPAC name of methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate (CID 70999461) is methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate.
What is the SMILES notation for methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate?
The canonical SMILES for methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate is COCC(COC)N(C(=O)C1CCCCC1)c1cc(F)c(O)cc1C(=O)OC.
What is the InChIKey of methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate?
The InChIKey is OMFSVRITDBVKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28FNO6/c1-26-11-14(12-27-2)22(19(24)13-7-5-4-6-8-13)17-10-16(21)18(23)9-15(17)20(25)28-3/h9-10,13-14,23H,4-8,11-12H2,1-3H3.
What are the key properties of methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate?
methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate has a molecular weight of 397.44 g/mol, XLogP of 2.89, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[cyclohexanecarbonyl(1,3-dimethoxypropan-2-yl)amino]-4-fluoro-5-hydroxybenzoate is sourced from PubChem (CID 70999461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).