C30H30F2N6O4 — CID 70999631
[(5S,6R,9S)-6-(2,3-difluorophenyl)-9-[2-oxo-2-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] carbamate (PubChem CID 70999631) has the molecular formula C30H30F2N6O4 and a molecular weight of 576.60 g/mol. Its IUPAC name is [(5S,6R,9S)-6-(2,3-difluorophenyl)-9-[2-oxo-2-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] carbamate.
| Compound Name | [(5S,6R,9S)-6-(2,3-difluorophenyl)-9-[2-oxo-2-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] carbamate |
|---|---|
| PubChem CID | 70999631 |
| Molecular Formula | C30H30F2N6O4 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | [(5S,6R,9S)-6-(2,3-difluorophenyl)-9-[2-oxo-2-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]ethyl]-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1c2cccnc2[C@H](CC(=O)N2CCC(n3c(=O)[nH]c4ncccc43)CC2)CC[C@@H]1c1cccc(F)c1F |
| InChI | InChI=1S/C30H30F2N6O4/c31-22-6-1-4-19(25(22)32)20-9-8-17(26-21(5-2-12-34-26)27(20)42-29(33)40)16-24(39)37-14-10-18(11-15-37)38-23-7-3-13-35-28(23)36-30(38)41/h1-7,12-13,17-18,20,27H,8-11,14-16H2,(H2,33,40)(H,35,36,41)/t17-,20+,27-/m0/s1 |
| InChIKey | LSQSSOSUFAZDKQ-JTTANEKDSA-N |
| XLogP | 4.45 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |