C23H25I — CID 70999727
(7Z,9Z)-3-(4-iodophenyl)-5,5,6,11-tetramethyl-6,11-dihydrobenzo[9]annulene (PubChem CID 70999727) has the molecular formula C23H25I and a molecular weight of 428.36 g/mol. Its IUPAC name is (7Z,9Z)-3-(4-iodophenyl)-5,5,6,11-tetramethyl-6,11-dihydrobenzo[9]annulene.
| Compound Name | (7Z,9Z)-3-(4-iodophenyl)-5,5,6,11-tetramethyl-6,11-dihydrobenzo[9]annulene |
|---|---|
| PubChem CID | 70999727 |
| Molecular Formula | C23H25I |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | (7Z,9Z)-3-(4-iodophenyl)-5,5,6,11-tetramethyl-6,11-dihydrobenzo[9]annulene |
| SMILES | CC1/C=C\C=C/C(C)C(C)(C)c2cc(-c3ccc(I)cc3)ccc21 |
| InChI | InChI=1S/C23H25I/c1-16-7-5-6-8-17(2)23(3,4)22-15-19(11-14-21(16)22)18-9-12-20(24)13-10-18/h5-17H,1-4H3/b7-5-,8-6- |
| InChIKey | XOIFPMFNRFVFJV-SFECMWDFSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|