About 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene
2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene (PubChem CID 70999731) has the molecular formula C25H23I
and a molecular weight of 450.36 g/mol. Its IUPAC name is 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene.
Molecular Properties
| Compound Name | 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene |
| PubChem CID | 70999731 |
| Molecular Formula | C25H23I |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene |
| SMILES | C/C(=C\c1ccccc1C)c1ccc2c(c1)C(C)(C)c1cc(I)ccc1-2 |
| InChI | InChI=1S/C25H23I/c1-16-7-5-6-8-18(16)13-17(2)19-9-11-21-22-12-10-20(26)15-24(22)25(3,4)23(21)14-19/h5-15H,1-4H3/b17-13+ |
| InChIKey | MRPGBMROXNHGJI-GHRIWEEISA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene?
The IUPAC name of 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene (CID 70999731) is 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene.
What is the SMILES notation for 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene?
The canonical SMILES for 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene is C/C(=C\c1ccccc1C)c1ccc2c(c1)C(C)(C)c1cc(I)ccc1-2.
What is the InChIKey of 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene?
The InChIKey is MRPGBMROXNHGJI-GHRIWEEISA-N. The full InChI is InChI=1S/C25H23I/c1-16-7-5-6-8-18(16)13-17(2)19-9-11-21-22-12-10-20(26)15-24(22)25(3,4)23(21)14-19/h5-15H,1-4H3/b17-13+.
What are the key properties of 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene?
2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene has a molecular weight of 450.36 g/mol, XLogP of 7.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-9,9-dimethyl-7-[(E)-1-(2-methylphenyl)prop-1-en-2-yl]fluorene is sourced from PubChem (CID 70999731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).