C27H29I — CID 70999735
1-[2-[(Z)-but-1-enyl]-1,3,3,5-tetramethyl-6H-inden-5-yl]-4-iodonaphthalene (PubChem CID 70999735) has the molecular formula C27H29I and a molecular weight of 480.43 g/mol. Its IUPAC name is 1-[2-[(Z)-but-1-enyl]-1,3,3,5-tetramethyl-6H-inden-5-yl]-4-iodonaphthalene.
| Compound Name | 1-[2-[(Z)-but-1-enyl]-1,3,3,5-tetramethyl-6H-inden-5-yl]-4-iodonaphthalene |
|---|---|
| PubChem CID | 70999735 |
| Molecular Formula | C27H29I |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1-[2-[(Z)-but-1-enyl]-1,3,3,5-tetramethyl-6H-inden-5-yl]-4-iodonaphthalene |
| SMILES | CC/C=C\C1=C(C)C2=CCC(C)(c3ccc(I)c4ccccc34)C=C2C1(C)C |
| InChI | InChI=1S/C27H29I/c1-6-7-12-22-18(2)19-15-16-27(5,17-24(19)26(22,3)4)23-13-14-25(28)21-11-9-8-10-20(21)23/h7-15,17H,6,16H2,1-5H3/b12-7- |
| InChIKey | VVMYMGTVWXAGIU-GHXNOFRVSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|