About 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid
2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid (PubChem CID 70999927) has the molecular formula C12H6Cl4O4S3
and a molecular weight of 452.19 g/mol. Its IUPAC name is 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid.
Molecular Properties
| Compound Name | 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid |
| PubChem CID | 70999927 |
| Molecular Formula | C12H6Cl4O4S3 |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 449.82 |
| IUPAC Name | 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid |
| SMILES | O=S(O)c1c(Cl)cc(S(=O)(=O)c2cc(Cl)c(S)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C12H6Cl4O4S3/c13-7-1-5(2-8(14)11(7)21)23(19,20)6-3-9(15)12(22(17)18)10(16)4-6/h1-4,21H,(H,17,18) |
| InChIKey | XPXYTWVQPIUQNC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid?
The IUPAC name of 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid (CID 70999927) is 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid.
What is the SMILES notation for 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid?
The canonical SMILES for 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid is O=S(O)c1c(Cl)cc(S(=O)(=O)c2cc(Cl)c(S)c(Cl)c2)cc1Cl.
What is the InChIKey of 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid?
The InChIKey is XPXYTWVQPIUQNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl4O4S3/c13-7-1-5(2-8(14)11(7)21)23(19,20)6-3-9(15)12(22(17)18)10(16)4-6/h1-4,21H,(H,17,18).
What are the key properties of 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid?
2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid has a molecular weight of 452.19 g/mol, XLogP of 5.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-(3,5-dichloro-4-sulfanylphenyl)sulfonylbenzenesulfinic acid is sourced from PubChem (CID 70999927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).