C26H25N7O7 — CID 71000848
4-[4-[[1-[2-[2-[[4-(2-oxoazetidine-1-carbonyl)phenyl]methoxy]ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]-1,2,4-triazole-3,5-dione (PubChem CID 71000848) has the molecular formula C26H25N7O7 and a molecular weight of 547.53 g/mol. Its IUPAC name is 4-[4-[[1-[2-[2-[[4-(2-oxoazetidine-1-carbonyl)phenyl]methoxy]ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]-1,2,4-triazole-3,5-dione.
| Compound Name | 4-[4-[[1-[2-[2-[[4-(2-oxoazetidine-1-carbonyl)phenyl]methoxy]ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]-1,2,4-triazole-3,5-dione |
|---|---|
| PubChem CID | 71000848 |
| Molecular Formula | C26H25N7O7 |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 4-[4-[[1-[2-[2-[[4-(2-oxoazetidine-1-carbonyl)phenyl]methoxy]ethoxy]ethyl]triazol-4-yl]methoxy]phenyl]-1,2,4-triazole-3,5-dione |
| SMILES | O=C1CCN1C(=O)c1ccc(COCCOCCn2cc(COc3ccc(N4C(=O)N=NC4=O)cc3)nn2)cc1 |
| InChI | InChI=1S/C26H25N7O7/c34-23-9-10-32(23)24(35)19-3-1-18(2-4-19)16-39-14-13-38-12-11-31-15-20(27-30-31)17-40-22-7-5-21(6-8-22)33-25(36)28-29-26(33)37/h1-8,15H,9-14,16-17H2 |
| InChIKey | UYPKLKMDJUXVHA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 157.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|