C20H40OSi — CID 71000984
[(1S,3aS,6aR)-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 71000984) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is [(1S,3aS,6aR)-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,3aS,6aR)-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 71000984 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | [(1S,3aS,6aR)-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCC1CC[C@H]2[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C20H40OSi/c1-8-9-17-10-11-19-18(17)12-13-20(19)21-22(14(2)3,15(4)5)16(6)7/h14-20H,8-13H2,1-7H3/t17?,18-,19+,20-/m0/s1 |
| InChIKey | QWPTVHYFRJYSBA-NXEWRWPSSA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|