C28H40F3NO4S — CID 71001621
(4S,7R,8S,9S,10E,13E,16R)-8-hydroxy-4,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 71001621) has the molecular formula C28H40F3NO4S and a molecular weight of 543.69 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13E,16R)-8-hydroxy-4,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13E,16R)-8-hydroxy-4,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 71001621 |
| Molecular Formula | C28H40F3NO4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (4S,7R,8S,9S,10E,13E,16R)-8-hydroxy-4,5,5,7,9-pentamethyl-16-[1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | Cc1nc(CC(C)[C@H]2C/C=C(/C(F)(F)F)C/C=C/[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)O2)cs1 |
| InChI | InChI=1S/C28H40F3NO4S/c1-16-9-8-10-21(28(29,30)31)11-12-23(17(2)13-22-15-37-20(5)32-22)36-24(33)14-18(3)27(6,7)26(35)19(4)25(16)34/h8-9,11,15-19,23,25,34H,10,12-14H2,1-7H3/b9-8+,21-11+/t16-,17?,18-,19+,23+,25-/m0/s1 |
| InChIKey | CUUYSEFVADNYCK-XQEMFRDLSA-N |
| XLogP | 6.64 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|