C17H22O4 — CID 71001624
(12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) propanoate (PubChem CID 71001624) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) propanoate.
| Compound Name | (12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) propanoate |
|---|---|
| PubChem CID | 71001624 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (12-oxo-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-4-yl) propanoate |
| SMILES | CCC(=O)OC1CC2CC1C1C3CC(C4COC(=O)C43)C21 |
| InChI | InChI=1S/C17H22O4/c1-2-13(18)21-12-4-7-3-9(12)15-10-5-8(14(7)15)11-6-20-17(19)16(10)11/h7-12,14-16H,2-6H2,1H3 |
| InChIKey | VOSFSSDKERKBQZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|