C28H45F3O6Si — CID 71001658
(4S,7R,8S,9S,10E,13E,16S)-16-acetyl-8-hydroxy-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 71001658) has the molecular formula C28H45F3O6Si and a molecular weight of 562.74 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13E,16S)-16-acetyl-8-hydroxy-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13E,16S)-16-acetyl-8-hydroxy-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 71001658 |
| Molecular Formula | C28H45F3O6Si |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | (4S,7R,8S,9S,10E,13E,16S)-16-acetyl-8-hydroxy-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(=O)O[C@H](C(C)=O)C/C=C(/C(F)(F)F)C/C=C/[C@H](C)[C@H](O)[C@@H](C)C(=O)C1(C)C |
| InChI | InChI=1S/C28H45F3O6Si/c1-9-38(10-2,11-3)37-23-17-24(33)36-22(20(6)32)16-15-21(28(29,30)31)14-12-13-18(4)25(34)19(5)26(35)27(23,7)8/h12-13,15,18-19,22-23,25,34H,9-11,14,16-17H2,1-8H3/b13-12+,21-15+/t18-,19+,22-,23-,25-/m0/s1 |
| InChIKey | SBJQDWLYMIQTQI-OSMPMKEJSA-N |
| XLogP | 6.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|