C8H15F3NO2+ — CID 71001790
4,4-dimethyl-2-(2,2,2-trifluoroethoxy)morpholin-4-ium (PubChem CID 71001790) has the molecular formula C8H15F3NO2+ and a molecular weight of 214.21 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2,2,2-trifluoroethoxy)morpholin-4-ium.
| Compound Name | 4,4-dimethyl-2-(2,2,2-trifluoroethoxy)morpholin-4-ium |
|---|---|
| PubChem CID | 71001790 |
| Molecular Formula | C8H15F3NO2+ |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 4,4-dimethyl-2-(2,2,2-trifluoroethoxy)morpholin-4-ium |
| SMILES | C[N+]1(C)CCOC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C8H15F3NO2/c1-12(2)3-4-13-7(5-12)14-6-8(9,10)11/h7H,3-6H2,1-2H3/q+1 |
| InChIKey | LZXPULDAMBXUAP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|