C23H18F3N5O2 — CID 71001821
2-amino-1-ethyl-3-(1H-imidazol-2-yl)-7-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1,8-naphthyridin-4-one (PubChem CID 71001821) has the molecular formula C23H18F3N5O2 and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-amino-1-ethyl-3-(1H-imidazol-2-yl)-7-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1,8-naphthyridin-4-one.
| Compound Name | 2-amino-1-ethyl-3-(1H-imidazol-2-yl)-7-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 71001821 |
| Molecular Formula | C23H18F3N5O2 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-amino-1-ethyl-3-(1H-imidazol-2-yl)-7-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1,8-naphthyridin-4-one |
| SMILES | CCn1c(N)c(-c2ncc[nH]2)c(=O)c2ccc(C#CC(O)(c3ccccc3)C(F)(F)F)nc21 |
| InChI | InChI=1S/C23H18F3N5O2/c1-2-31-19(27)17(20-28-12-13-29-20)18(32)16-9-8-15(30-21(16)31)10-11-22(33,23(24,25)26)14-6-4-3-5-7-14/h3-9,12-13,33H,2,27H2,1H3,(H,28,29) |
| InChIKey | NGTDOGBAVXLEFQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|