C23H33NO3Si — CID 71002737
(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[hydroxy(diphenyl)silyl]-4-methylpentan-1-amine (PubChem CID 71002737) has the molecular formula C23H33NO3Si and a molecular weight of 399.61 g/mol. Its IUPAC name is (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[hydroxy(diphenyl)silyl]-4-methylpentan-1-amine.
| Compound Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[hydroxy(diphenyl)silyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 71002737 |
| Molecular Formula | C23H33NO3Si |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[hydroxy(diphenyl)silyl]-4-methylpentan-1-amine |
| SMILES | CC1(C)OC[C@H]([C@H](N)CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C23H33NO3Si/c1-22(2,16-15-20(24)21-17-26-23(3,4)27-21)28(25,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-21,25H,15-17,24H2,1-4H3/t20-,21-/m1/s1 |
| InChIKey | NXFWJRMYBROKMK-NHCUHLMSSA-N |
| XLogP | 2.78 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|