About (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine
(4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine (PubChem CID 71002750) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine.
Molecular Properties
| Compound Name | (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine |
| PubChem CID | 71002750 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine |
| SMILES | CCCCOc1ncnc2c(CN)c[nH]c12 |
| InChI | InChI=1S/C11H16N4O/c1-2-3-4-16-11-10-9(14-7-15-11)8(5-12)6-13-10/h6-7,13H,2-5,12H2,1H3 |
| InChIKey | SOJFCXGKQZFPFG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine?
The IUPAC name of (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine (CID 71002750) is (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine.
What is the SMILES notation for (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine?
The canonical SMILES for (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine is CCCCOc1ncnc2c(CN)c[nH]c12.
What is the InChIKey of (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine?
The InChIKey is SOJFCXGKQZFPFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-2-3-4-16-11-10-9(14-7-15-11)8(5-12)6-13-10/h6-7,13H,2-5,12H2,1H3.
What are the key properties of (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine?
(4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine has a molecular weight of 220.28 g/mol, XLogP of 1.60, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxy-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methanamine is sourced from PubChem (CID 71002750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).