C11H17N4O5P — CID 71002798
4-[(2,4-dioxo-1,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butylphosphonic acid (PubChem CID 71002798) has the molecular formula C11H17N4O5P and a molecular weight of 316.25 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butylphosphonic acid.
| Compound Name | 4-[(2,4-dioxo-1,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butylphosphonic acid |
|---|---|
| PubChem CID | 71002798 |
| Molecular Formula | C11H17N4O5P |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[(2,4-dioxo-1,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butylphosphonic acid |
| SMILES | O=c1[nH]c(=O)c2[nH]cc(CNCCCCP(=O)(O)O)c2[nH]1 |
| InChI | InChI=1S/C11H17N4O5P/c16-10-9-8(14-11(17)15-10)7(6-13-9)5-12-3-1-2-4-21(18,19)20/h6,12-13H,1-5H2,(H2,18,19,20)(H2,14,15,16,17) |
| InChIKey | QLOMVCIDZBTQJL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 151.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|