C28H36N4O5 — CID 71002860
[(1S,4R,6S,7Z,14S,18R)-4-carbamoyl-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate (PubChem CID 71002860) has the molecular formula C28H36N4O5 and a molecular weight of 508.62 g/mol. Its IUPAC name is [(1S,4R,6S,7Z,14S,18R)-4-carbamoyl-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(1S,4R,6S,7Z,14S,18R)-4-carbamoyl-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 71002860 |
| Molecular Formula | C28H36N4O5 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(1S,4R,6S,7Z,14S,18R)-4-carbamoyl-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 1,3-dihydroisoindole-2-carboxylate |
| SMILES | C[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(N)=O)NC(=O)[C@@H]2C[C@@H](OC(=O)N3Cc4ccccc4C3)CN2C1=O |
| InChI | InChI=1S/C28H36N4O5/c1-18-9-5-3-2-4-6-12-21-14-28(21,26(29)35)30-24(33)23-13-22(17-32(23)25(18)34)37-27(36)31-15-19-10-7-8-11-20(19)16-31/h6-8,10-12,18,21-23H,2-5,9,13-17H2,1H3,(H2,29,35)(H,30,33)/b12-6-/t18-,21+,22+,23-,28+/m0/s1 |
| InChIKey | LXHRFRZNDRRDED-DWXGJFDHSA-N |
| XLogP | 2.62 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|