C14H22N6O — CID 71002871
6-methyl-8-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 71002871) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 6-methyl-8-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 6-methyl-8-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 71002871 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 6-methyl-8-(3-piperazin-1-ylpropylamino)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | Cc1cc(NCCCN2CCNCC2)c2n[nH]c(=O)n2c1 |
| InChI | InChI=1S/C14H22N6O/c1-11-9-12(13-17-18-14(21)20(13)10-11)16-3-2-6-19-7-4-15-5-8-19/h9-10,15-16H,2-8H2,1H3,(H,18,21) |
| InChIKey | UIGOLTQPMBFMML-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|