About (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol
(1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol (PubChem CID 71003021) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol.
Molecular Properties
| Compound Name | (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol |
| PubChem CID | 71003021 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol |
| SMILES | CC(C)(C)C1CC=C([C@@H](O)[C@@H](N)CO)CC1 |
| InChI | InChI=1S/C13H25NO2/c1-13(2,3)10-6-4-9(5-7-10)12(16)11(14)8-15/h4,10-12,15-16H,5-8,14H2,1-3H3/t10?,11-,12+/m0/s1 |
| InChIKey | AQVDAHVYSAAMBM-GLXQMMQGSA-N |
| XLogP | 1.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol?
The IUPAC name of (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol (CID 71003021) is (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol.
What is the SMILES notation for (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol?
The canonical SMILES for (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol is CC(C)(C)C1CC=C([C@@H](O)[C@@H](N)CO)CC1.
What is the InChIKey of (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol?
The InChIKey is AQVDAHVYSAAMBM-GLXQMMQGSA-N. The full InChI is InChI=1S/C13H25NO2/c1-13(2,3)10-6-4-9(5-7-10)12(16)11(14)8-15/h4,10-12,15-16H,5-8,14H2,1-3H3/t10?,11-,12+/m0/s1.
What are the key properties of (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol?
(1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol has a molecular weight of 227.35 g/mol, XLogP of 1.44, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-amino-1-(4-tert-butylcyclohexen-1-yl)propane-1,3-diol is sourced from PubChem (CID 71003021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).