C20H32O6 — CID 71003157
methyl 2-[(1R,3R,7S,10S)-1-ethylspiro[4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecane-5,1'-cyclohexane]-13-yl]acetate (PubChem CID 71003157) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is methyl 2-[(1R,3R,7S,10S)-1-ethylspiro[4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecane-5,1'-cyclohexane]-13-yl]acetate.
| Compound Name | methyl 2-[(1R,3R,7S,10S)-1-ethylspiro[4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecane-5,1'-cyclohexane]-13-yl]acetate |
|---|---|
| PubChem CID | 71003157 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | methyl 2-[(1R,3R,7S,10S)-1-ethylspiro[4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecane-5,1'-cyclohexane]-13-yl]acetate |
| SMILES | CC[C@@]12C[C@H]3OC4(CCCCC4)O[C@H]3CO[C@H]1CCC(CC(=O)OC)O2 |
| InChI | InChI=1S/C20H32O6/c1-3-19-12-15-16(26-20(25-15)9-5-4-6-10-20)13-23-17(19)8-7-14(24-19)11-18(21)22-2/h14-17H,3-13H2,1-2H3/t14?,15-,16+,17+,19-/m1/s1 |
| InChIKey | SAFKURXDONXUIT-JFPBGICNSA-N |
| XLogP | 3.11 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |