About 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile
3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile (PubChem CID 71003167) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile |
| PubChem CID | 71003167 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile |
| SMILES | N#CCCC1CCC2O[C@H]3CC=CC2(C3)O1 |
| InChI | InChI=1S/C13H17NO2/c14-8-2-4-10-5-6-12-13(16-10)7-1-3-11(9-13)15-12/h1,7,10-12H,2-6,9H2/t10?,11-,12?,13?/m0/s1 |
| InChIKey | ZJNLUPLLBWBZAV-ZNOXQBFJSA-N |
| XLogP | 2.33 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile?
The IUPAC name of 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile (CID 71003167) is 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile.
What is the SMILES notation for 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile?
The canonical SMILES for 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile is N#CCCC1CCC2O[C@H]3CC=CC2(C3)O1.
What is the InChIKey of 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile?
The InChIKey is ZJNLUPLLBWBZAV-ZNOXQBFJSA-N. The full InChI is InChI=1S/C13H17NO2/c14-8-2-4-10-5-6-12-13(16-10)7-1-3-11(9-13)15-12/h1,7,10-12H,2-6,9H2/t10?,11-,12?,13?/m0/s1.
What are the key properties of 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile?
3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile has a molecular weight of 219.28 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(8S)-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-3-yl]propanenitrile is sourced from PubChem (CID 71003167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).