C17H30O7Si — CID 71003179
methyl 2-[(4aR)-3,4-dihydroxy-2-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 71003179) has the molecular formula C17H30O7Si and a molecular weight of 374.51 g/mol. Its IUPAC name is methyl 2-[(4aR)-3,4-dihydroxy-2-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(4aR)-3,4-dihydroxy-2-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 71003179 |
| Molecular Formula | C17H30O7Si |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | methyl 2-[(4aR)-3,4-dihydroxy-2-[(E)-1-hydroxy-3-trimethylsilylprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | COC(=O)CC1CCC2OC(C(O)/C=C/[Si](C)(C)C)C(O)C(O)[C@H]2O1 |
| InChI | InChI=1S/C17H30O7Si/c1-22-13(19)9-10-5-6-12-17(23-10)15(21)14(20)16(24-12)11(18)7-8-25(2,3)4/h7-8,10-12,14-18,20-21H,5-6,9H2,1-4H3/b8-7+/t10?,11?,12?,14?,15?,16?,17-/m0/s1 |
| InChIKey | HUFKGJIHAXCDPH-DVIXNMJWSA-N |
| XLogP | 0.38 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|