C24H27N3O6 — CID 71003405
methyl 2-[2-[(3,4-dihydroxyphenyl)-[4-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]-1,3-benzodioxol-5-yl]acetate (PubChem CID 71003405) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is methyl 2-[2-[(3,4-dihydroxyphenyl)-[4-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]-1,3-benzodioxol-5-yl]acetate.
| Compound Name | methyl 2-[2-[(3,4-dihydroxyphenyl)-[4-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]-1,3-benzodioxol-5-yl]acetate |
|---|---|
| PubChem CID | 71003405 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | methyl 2-[2-[(3,4-dihydroxyphenyl)-[4-[2-(dimethylamino)ethyl]imidazol-1-yl]methyl]-1,3-benzodioxol-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)OC(C(c1ccc(O)c(O)c1)n1cnc(CCN(C)C)c1)O2 |
| InChI | InChI=1S/C24H27N3O6/c1-26(2)9-8-17-13-27(14-25-17)23(16-5-6-18(28)19(29)12-16)24-32-20-7-4-15(10-21(20)33-24)11-22(30)31-3/h4-7,10,12-14,23-24,28-29H,8-9,11H2,1-3H3 |
| InChIKey | VFYFQPRGRDBZMN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|