C14H21N2O+ — CID 7100355
1-[(2R)-2-ethylpiperidin-1-yl]-2-pyridin-1-ium-1-ylethanone (PubChem CID 7100355) has the molecular formula C14H21N2O+ and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-[(2R)-2-ethylpiperidin-1-yl]-2-pyridin-1-ium-1-ylethanone.
| Compound Name | 1-[(2R)-2-ethylpiperidin-1-yl]-2-pyridin-1-ium-1-ylethanone |
|---|---|
| PubChem CID | 7100355 |
| Molecular Formula | C14H21N2O+ |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-[(2R)-2-ethylpiperidin-1-yl]-2-pyridin-1-ium-1-ylethanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)C[n+]1ccccc1 |
| InChI | InChI=1S/C14H21N2O/c1-2-13-8-4-7-11-16(13)14(17)12-15-9-5-3-6-10-15/h3,5-6,9-10,13H,2,4,7-8,11-12H2,1H3/q+1/t13-/m1/s1 |
| InChIKey | KLDWMXXQJGDCTC-CYBMUJFWSA-N |
| XLogP | 1.77 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|