About 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate
2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate (PubChem CID 71003667) has the molecular formula C14H14F3NO3
and a molecular weight of 301.26 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate |
| PubChem CID | 71003667 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1=NC(c2ccc(C(F)(F)F)cc2)CO1 |
| InChI | InChI=1S/C14H14F3NO3/c1-9(19)20-7-6-13-18-12(8-21-13)10-2-4-11(5-3-10)14(15,16)17/h2-5,12H,6-8H2,1H3 |
| InChIKey | NCODVHRLHRPBPF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate?
The IUPAC name of 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate (CID 71003667) is 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate.
What is the SMILES notation for 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate?
The canonical SMILES for 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate is CC(=O)OCCC1=NC(c2ccc(C(F)(F)F)cc2)CO1.
What is the InChIKey of 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate?
The InChIKey is NCODVHRLHRPBPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3NO3/c1-9(19)20-7-6-13-18-12(8-21-13)10-2-4-11(5-3-10)14(15,16)17/h2-5,12H,6-8H2,1H3.
What are the key properties of 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate?
2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate has a molecular weight of 301.26 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]ethyl acetate is sourced from PubChem (CID 71003667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).