C21H26BrN3O2 — CID 71003718
N'-[5-bromo-6-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 71003718) has the molecular formula C21H26BrN3O2 and a molecular weight of 432.36 g/mol. Its IUPAC name is N'-[5-bromo-6-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-bromo-6-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 71003718 |
| Molecular Formula | C21H26BrN3O2 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N'-[5-bromo-6-[(8-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Br)c(OC2CCc3cccc(OC)c3C2)nc1C |
| InChI | InChI=1S/C21H26BrN3O2/c1-5-25(3)13-23-19-12-18(22)21(24-14(19)2)27-16-10-9-15-7-6-8-20(26-4)17(15)11-16/h6-8,12-13,16H,5,9-11H2,1-4H3/b23-13+ |
| InChIKey | BUSJZZZHWPAXPS-YDZHTSKRSA-N |
| XLogP | 4.71 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|