About 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one
3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one (PubChem CID 71003969) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one |
| PubChem CID | 71003969 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NC(Cc2ccccc2)c2cc(O)ccc21 |
| InChI | InChI=1S/C15H13NO2/c17-11-6-7-12-13(9-11)14(16-15(12)18)8-10-4-2-1-3-5-10/h1-7,9,14,17H,8H2,(H,16,18) |
| InChIKey | QDYOSINPFKWZGD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one (CID 71003969) is 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one is O=C1NC(Cc2ccccc2)c2cc(O)ccc21.
What is the InChIKey of 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one?
The InChIKey is QDYOSINPFKWZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2/c17-11-6-7-12-13(9-11)14(16-15(12)18)8-10-4-2-1-3-5-10/h1-7,9,14,17H,8H2,(H,16,18).
What are the key properties of 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one?
3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one has a molecular weight of 239.27 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-hydroxy-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 71003969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).