C14H22N6O4 — CID 71004119
(2R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]pentane-1,3,4-triol (PubChem CID 71004119) has the molecular formula C14H22N6O4 and a molecular weight of 338.37 g/mol. Its IUPAC name is (2R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]pentane-1,3,4-triol.
| Compound Name | (2R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]pentane-1,3,4-triol |
|---|---|
| PubChem CID | 71004119 |
| Molecular Formula | C14H22N6O4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2R)-2-[[2-amino-6-(cyclopropylamino)purin-9-yl]methoxy]pentane-1,3,4-triol |
| SMILES | CC(O)C(O)[C@@H](CO)OCn1cnc2c(NC3CC3)nc(N)nc21 |
| InChI | InChI=1S/C14H22N6O4/c1-7(22)11(23)9(4-21)24-6-20-5-16-10-12(17-8-2-3-8)18-14(15)19-13(10)20/h5,7-9,11,21-23H,2-4,6H2,1H3,(H3,15,17,18,19)/t7?,9-,11?/m1/s1 |
| InChIKey | CGMRZYWNPQEYKV-PUDKOPFASA-N |
| XLogP | -0.94 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |