C11H15N3O2 — CID 71004642
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-aminofuran-2-yl)methanone (PubChem CID 71004642) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-aminofuran-2-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-aminofuran-2-yl)methanone |
|---|---|
| PubChem CID | 71004642 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-aminofuran-2-yl)methanone |
| SMILES | Nc1coc(C(=O)N2CC3CNCC3C2)c1 |
| InChI | InChI=1S/C11H15N3O2/c12-9-1-10(16-6-9)11(15)14-4-7-2-13-3-8(7)5-14/h1,6-8,13H,2-5,12H2 |
| InChIKey | YMTSIWYNURBYAS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |