C24H24F3N7O — CID 71004774
2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N,N-dimethylquinoline-7-carboxamide (PubChem CID 71004774) has the molecular formula C24H24F3N7O and a molecular weight of 483.50 g/mol. Its IUPAC name is 2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N,N-dimethylquinoline-7-carboxamide.
| Compound Name | 2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N,N-dimethylquinoline-7-carboxamide |
|---|---|
| PubChem CID | 71004774 |
| Molecular Formula | C24H24F3N7O |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-N,N-dimethylquinoline-7-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2ccc(-c3nnc4ccc([C@@H](N5CC[C@H](N)C5)C(F)(F)F)cn34)nc2c1 |
| InChI | InChI=1S/C24H24F3N7O/c1-32(2)23(35)15-4-3-14-5-7-18(29-19(14)11-15)22-31-30-20-8-6-16(12-34(20)22)21(24(25,26)27)33-10-9-17(28)13-33/h3-8,11-12,17,21H,9-10,13,28H2,1-2H3/t17-,21+/m0/s1 |
| InChIKey | FORRNIQCBQDRBR-LAUBAEHRSA-N |
| XLogP | 3.28 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |